C33H60O3Si3 — CID 172708378
[2,4-bis[[cyclohexylmethyl(ethenyl)silyl]oxy]cyclohexyl]oxy-(cyclohexylmethyl)-ethenylsilane (PubChem CID 172708378) has the molecular formula C33H60O3Si3 and a molecular weight of 589.10 g/mol. Its IUPAC name is [2,4-bis[[cyclohexylmethyl(ethenyl)silyl]oxy]cyclohexyl]oxy-(cyclohexylmethyl)-ethenylsilane.
| Compound Name | [2,4-bis[[cyclohexylmethyl(ethenyl)silyl]oxy]cyclohexyl]oxy-(cyclohexylmethyl)-ethenylsilane |
|---|---|
| PubChem CID | 172708378 |
| Molecular Formula | C33H60O3Si3 |
| Molecular Weight | 589.10 g/mol |
| Exact Mass | 588.39 |
| IUPAC Name | [2,4-bis[[cyclohexylmethyl(ethenyl)silyl]oxy]cyclohexyl]oxy-(cyclohexylmethyl)-ethenylsilane |
| SMILES | C=C[SiH](CC1CCCCC1)OC1CCC(O[SiH](C=C)CC2CCCCC2)C(O[SiH](C=C)CC2CCCCC2)C1 |
| InChI | InChI=1S/C33H60O3Si3/c1-4-37(25-28-16-10-7-11-17-28)34-31-22-23-32(35-38(5-2)26-29-18-12-8-13-19-29)33(24-31)36-39(6-3)27-30-20-14-9-15-21-30/h4-6,28-33,37-39H,1-3,7-27H2 |
| InChIKey | DXFFDWSSXVADGQ-UHFFFAOYSA-N |
| XLogP | 8.41 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.10 |
| LogP ≤ 5 | 8.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|