C42H76Si4 — CID 172856999
cyclohexylmethyl-ethenyl-[2,4,5-tris[cyclohexylmethyl(ethenyl)silyl]cyclohexyl]silane (PubChem CID 172856999) has the molecular formula C42H76Si4 and a molecular weight of 693.41 g/mol. Its IUPAC name is cyclohexylmethyl-ethenyl-[2,4,5-tris[cyclohexylmethyl(ethenyl)silyl]cyclohexyl]silane.
| Compound Name | cyclohexylmethyl-ethenyl-[2,4,5-tris[cyclohexylmethyl(ethenyl)silyl]cyclohexyl]silane |
|---|---|
| PubChem CID | 172856999 |
| Molecular Formula | C42H76Si4 |
| Molecular Weight | 693.41 g/mol |
| Exact Mass | 692.50 |
| IUPAC Name | cyclohexylmethyl-ethenyl-[2,4,5-tris[cyclohexylmethyl(ethenyl)silyl]cyclohexyl]silane |
| SMILES | C=C[SiH](CC1CCCCC1)C1CC([SiH](C=C)CC2CCCCC2)C([SiH](C=C)CC2CCCCC2)CC1[SiH](C=C)CC1CCCCC1 |
| InChI | InChI=1S/C42H76Si4/c1-5-43(31-35-21-13-9-14-22-35)39-29-41(45(7-3)33-37-25-17-11-18-26-37)42(46(8-4)34-38-27-19-12-20-28-38)30-40(39)44(6-2)32-36-23-15-10-16-24-36/h5-8,35-46H,1-4,9-34H2 |
| InChIKey | YVNBAUDYLJLLPD-UHFFFAOYSA-N |
| XLogP | 12.39 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 16 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 693.41 |
| LogP ≤ 5 | 12.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|