C11H19NO9 — CID 172708521
(2R)-2-[(4R,5S,6R)-2,5-dihydroxy-2-[(2-hydroxyacetyl)amino]-6-(hydroxymethyl)oxan-4-yl]oxypropanoic acid (PubChem CID 172708521) has the molecular formula C11H19NO9 and a molecular weight of 309.27 g/mol. Its IUPAC name is (2R)-2-[(4R,5S,6R)-2,5-dihydroxy-2-[(2-hydroxyacetyl)amino]-6-(hydroxymethyl)oxan-4-yl]oxypropanoic acid.
| Compound Name | (2R)-2-[(4R,5S,6R)-2,5-dihydroxy-2-[(2-hydroxyacetyl)amino]-6-(hydroxymethyl)oxan-4-yl]oxypropanoic acid |
|---|---|
| PubChem CID | 172708521 |
| Molecular Formula | C11H19NO9 |
| Molecular Weight | 309.27 g/mol |
| Exact Mass | 309.11 |
| IUPAC Name | (2R)-2-[(4R,5S,6R)-2,5-dihydroxy-2-[(2-hydroxyacetyl)amino]-6-(hydroxymethyl)oxan-4-yl]oxypropanoic acid |
| SMILES | C[C@@H](O[C@@H]1CC(O)(NC(=O)CO)O[C@H](CO)[C@H]1O)C(=O)O |
| InChI | InChI=1S/C11H19NO9/c1-5(10(17)18)20-6-2-11(19,12-8(15)4-14)21-7(3-13)9(6)16/h5-7,9,13-14,16,19H,2-4H2,1H3,(H,12,15)(H,17,18)/t5-,6-,7-,9+,11?/m1/s1 |
| InChIKey | DXRADBGVWKTASK-RDKIJXGQSA-N |
| XLogP | -3.26 |
| TPSA | 165.78 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.27 |
| LogP ≤ 5 | -3.26 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|