C8H15NO9S — CID 57322958
[(2R,4S,5R,6R)-2-acetamido-2,5-dihydroxy-6-(hydroxymethyl)oxan-4-yl] hydrogen sulfate (PubChem CID 57322958) has the molecular formula C8H15NO9S and a molecular weight of 301.27 g/mol. Its IUPAC name is [(2R,4S,5R,6R)-2-acetamido-2,5-dihydroxy-6-(hydroxymethyl)oxan-4-yl] hydrogen sulfate.
| Compound Name | [(2R,4S,5R,6R)-2-acetamido-2,5-dihydroxy-6-(hydroxymethyl)oxan-4-yl] hydrogen sulfate |
|---|---|
| PubChem CID | 57322958 |
| Molecular Formula | C8H15NO9S |
| Molecular Weight | 301.27 g/mol |
| Exact Mass | 301.05 |
| IUPAC Name | [(2R,4S,5R,6R)-2-acetamido-2,5-dihydroxy-6-(hydroxymethyl)oxan-4-yl] hydrogen sulfate |
| SMILES | CC(=O)N[C@@]1(O)C[C@H](OS(=O)(=O)O)[C@H](O)[C@@H](CO)O1 |
| InChI | InChI=1S/C8H15NO9S/c1-4(11)9-8(13)2-5(18-19(14,15)16)7(12)6(3-10)17-8/h5-7,10,12-13H,2-3H2,1H3,(H,9,11)(H,14,15,16)/t5-,6+,7-,8+/m0/s1 |
| InChIKey | GXHACIHKSCNRPO-FKSUSPILSA-N |
| XLogP | -2.90 |
| TPSA | 162.62 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.27 |
| LogP ≤ 5 | -2.90 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|