C8H15NO12S2 — CID 154409546
[(2R,3R,4R,5R)-6-acetyl-5-amino-4,6-dihydroxy-2-(sulfooxymethyl)oxan-3-yl] hydrogen sulfate (PubChem CID 154409546) has the molecular formula C8H15NO12S2 and a molecular weight of 381.34 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-6-acetyl-5-amino-4,6-dihydroxy-2-(sulfooxymethyl)oxan-3-yl] hydrogen sulfate.
| Compound Name | [(2R,3R,4R,5R)-6-acetyl-5-amino-4,6-dihydroxy-2-(sulfooxymethyl)oxan-3-yl] hydrogen sulfate |
|---|---|
| PubChem CID | 154409546 |
| Molecular Formula | C8H15NO12S2 |
| Molecular Weight | 381.34 g/mol |
| Exact Mass | 381.00 |
| IUPAC Name | [(2R,3R,4R,5R)-6-acetyl-5-amino-4,6-dihydroxy-2-(sulfooxymethyl)oxan-3-yl] hydrogen sulfate |
| SMILES | CC(=O)C1(O)O[C@H](COS(=O)(=O)O)[C@H](OS(=O)(=O)O)[C@H](O)[C@H]1N |
| InChI | InChI=1S/C8H15NO12S2/c1-3(10)8(12)7(9)5(11)6(21-23(16,17)18)4(20-8)2-19-22(13,14)15/h4-7,11-12H,2,9H2,1H3,(H,13,14,15)(H,16,17,18)/t4-,5+,6+,7-,8?/m1/s1 |
| InChIKey | SGYGTSHMASTHET-XLSKCSLXSA-N |
| XLogP | -3.64 |
| TPSA | 219.98 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.34 |
| LogP ≤ 5 | -3.64 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|