About [dihydroxy(oxo)-λ6-sulfanylidene]-[(4-phenylphenyl)methyl]sulfanium
[dihydroxy(oxo)-λ6-sulfanylidene]-[(4-phenylphenyl)methyl]sulfanium (PubChem CID 172708889) has the molecular formula C13H13O3S2+
and a molecular weight of 281.38 g/mol. Its IUPAC name is [dihydroxy(oxo)-λ6-sulfanylidene]-[(4-phenylphenyl)methyl]sulfanium.
Molecular Properties
| Compound Name | [dihydroxy(oxo)-λ6-sulfanylidene]-[(4-phenylphenyl)methyl]sulfanium |
| PubChem CID | 172708889 |
| Molecular Formula | C13H13O3S2+ |
| Molecular Weight | 281.38 g/mol |
| Exact Mass | 281.03 |
| IUPAC Name | [dihydroxy(oxo)-λ6-sulfanylidene]-[(4-phenylphenyl)methyl]sulfanium |
| SMILES | O=S(O)(O)=[S+]Cc1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C13H12O3S2/c14-18(15,16)17-10-11-6-8-13(9-7-11)12-4-2-1-3-5-12/h1-9H,10H2,(H-,14,15,16)/p+1 |
| InChIKey | KQQNIDXQMJJHNA-UHFFFAOYSA-O |
| XLogP | 3.08 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.38 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|
Analyze [dihydroxy(oxo)-λ6-sulfanylidene]-[(4-phenylphenyl)methyl]sulfanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [dihydroxy(oxo)-λ6-sulfanylidene]-[(4-phenylphenyl)methyl]sulfanium?
The IUPAC name of [dihydroxy(oxo)-λ6-sulfanylidene]-[(4-phenylphenyl)methyl]sulfanium (CID 172708889) is [dihydroxy(oxo)-λ6-sulfanylidene]-[(4-phenylphenyl)methyl]sulfanium.
What is the SMILES notation for [dihydroxy(oxo)-λ6-sulfanylidene]-[(4-phenylphenyl)methyl]sulfanium?
The canonical SMILES for [dihydroxy(oxo)-λ6-sulfanylidene]-[(4-phenylphenyl)methyl]sulfanium is O=S(O)(O)=[S+]Cc1ccc(-c2ccccc2)cc1.
What is the InChIKey of [dihydroxy(oxo)-λ6-sulfanylidene]-[(4-phenylphenyl)methyl]sulfanium?
The InChIKey is KQQNIDXQMJJHNA-UHFFFAOYSA-O. The full InChI is InChI=1S/C13H12O3S2/c14-18(15,16)17-10-11-6-8-13(9-7-11)12-4-2-1-3-5-12/h1-9H,10H2,(H-,14,15,16)/p+1.
What are the key properties of [dihydroxy(oxo)-λ6-sulfanylidene]-[(4-phenylphenyl)methyl]sulfanium?
[dihydroxy(oxo)-λ6-sulfanylidene]-[(4-phenylphenyl)methyl]sulfanium has a molecular weight of 281.38 g/mol, XLogP of 3.08, 3 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [dihydroxy(oxo)-λ6-sulfanylidene]-[(4-phenylphenyl)methyl]sulfanium is sourced from PubChem (CID 172708889), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).