C15H20N2 — CID 172709341
2-N-phenyl-1-propan-2-ylcyclohexa-3,5-diene-1,2-diamine (PubChem CID 172709341) has the molecular formula C15H20N2 and a molecular weight of 228.34 g/mol. Its IUPAC name is 2-N-phenyl-1-propan-2-ylcyclohexa-3,5-diene-1,2-diamine.
| Compound Name | 2-N-phenyl-1-propan-2-ylcyclohexa-3,5-diene-1,2-diamine |
|---|---|
| PubChem CID | 172709341 |
| Molecular Formula | C15H20N2 |
| Molecular Weight | 228.34 g/mol |
| Exact Mass | 228.16 |
| IUPAC Name | 2-N-phenyl-1-propan-2-ylcyclohexa-3,5-diene-1,2-diamine |
| SMILES | CC(C)C1(N)C=CC=CC1Nc1ccccc1 |
| InChI | InChI=1S/C15H20N2/c1-12(2)15(16)11-7-6-10-14(15)17-13-8-4-3-5-9-13/h3-12,14,17H,16H2,1-2H3 |
| InChIKey | FAMQJOUYPKRSFE-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.34 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |