C12H11F2NO5 — CID 172713269
2-(1-deuterio-2,2-difluoroethenoxy)-1,3-dimethoxy-5-(2-nitroethenyl)benzene (PubChem CID 172713269) has the molecular formula C12H11F2NO5 and a molecular weight of 288.22 g/mol. Its IUPAC name is 2-(1-deuterio-2,2-difluoroethenoxy)-1,3-dimethoxy-5-(2-nitroethenyl)benzene.
| Compound Name | 2-(1-deuterio-2,2-difluoroethenoxy)-1,3-dimethoxy-5-(2-nitroethenyl)benzene |
|---|---|
| PubChem CID | 172713269 |
| Molecular Formula | C12H11F2NO5 |
| Molecular Weight | 288.22 g/mol |
| Exact Mass | 288.07 |
| IUPAC Name | 2-(1-deuterio-2,2-difluoroethenoxy)-1,3-dimethoxy-5-(2-nitroethenyl)benzene |
| SMILES | [2H]C(Oc1c(OC)cc(C=C[N+](=O)[O-])cc1OC)=C(F)F |
| InChI | InChI=1S/C12H11F2NO5/c1-18-9-5-8(3-4-15(16)17)6-10(19-2)12(9)20-7-11(13)14/h3-7H,1-2H3/i7D |
| InChIKey | FNIFDIGCXGMZPT-WHRKIXHSSA-N |
| XLogP | 3.07 |
| TPSA | 70.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.22 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|