C14H16N2O2 — CID 172713358
tert-butyl 6H-1,4-benzodiazepine-5-carboxylate (PubChem CID 172713358) has the molecular formula C14H16N2O2 and a molecular weight of 244.29 g/mol. Its IUPAC name is tert-butyl 6H-1,4-benzodiazepine-5-carboxylate.
| Compound Name | tert-butyl 6H-1,4-benzodiazepine-5-carboxylate |
|---|---|
| PubChem CID | 172713358 |
| Molecular Formula | C14H16N2O2 |
| Molecular Weight | 244.29 g/mol |
| Exact Mass | 244.12 |
| IUPAC Name | tert-butyl 6H-1,4-benzodiazepine-5-carboxylate |
| SMILES | CC(C)(C)OC(=O)C1=C2CC=CC=C2N=CC=N1 |
| InChI | InChI=1S/C14H16N2O2/c1-14(2,3)18-13(17)12-10-6-4-5-7-11(10)15-8-9-16-12/h4-5,7-9H,6H2,1-3H3 |
| InChIKey | FNPILQSUIRUHLF-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.29 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |