About isocyanic acid;methyl (2R)-2-amino-3-(4-bromophenyl)-2-methylpropanoate
isocyanic acid;methyl (2R)-2-amino-3-(4-bromophenyl)-2-methylpropanoate (PubChem CID 172715255) has the molecular formula C12H15BrN2O3
and a molecular weight of 315.17 g/mol. Its IUPAC name is isocyanic acid;methyl (2R)-2-amino-3-(4-bromophenyl)-2-methylpropanoate.
Molecular Properties
| Compound Name | isocyanic acid;methyl (2R)-2-amino-3-(4-bromophenyl)-2-methylpropanoate |
| PubChem CID | 172715255 |
| Molecular Formula | C12H15BrN2O3 |
| Molecular Weight | 315.17 g/mol |
| Exact Mass | 314.03 |
| IUPAC Name | isocyanic acid;methyl (2R)-2-amino-3-(4-bromophenyl)-2-methylpropanoate |
| SMILES | COC(=O)[C@](C)(N)Cc1ccc(Br)cc1.N=C=O |
| InChI | InChI=1S/C11H14BrNO2.CHNO/c1-11(13,10(14)15-2)7-8-3-5-9(12)6-4-8;2-1-3/h3-6H,7,13H2,1-2H3;2H/t11-;/m1./s1 |
| InChIKey | FTUVBAYUPFNMED-RFVHGSKJSA-N |
| XLogP | 1.78 |
| TPSA | 93.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.17 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|
Analyze isocyanic acid;methyl (2R)-2-amino-3-(4-bromophenyl)-2-methylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of isocyanic acid;methyl (2R)-2-amino-3-(4-bromophenyl)-2-methylpropanoate?
The IUPAC name of isocyanic acid;methyl (2R)-2-amino-3-(4-bromophenyl)-2-methylpropanoate (CID 172715255) is isocyanic acid;methyl (2R)-2-amino-3-(4-bromophenyl)-2-methylpropanoate.
What is the SMILES notation for isocyanic acid;methyl (2R)-2-amino-3-(4-bromophenyl)-2-methylpropanoate?
The canonical SMILES for isocyanic acid;methyl (2R)-2-amino-3-(4-bromophenyl)-2-methylpropanoate is COC(=O)[C@](C)(N)Cc1ccc(Br)cc1.N=C=O.
What is the InChIKey of isocyanic acid;methyl (2R)-2-amino-3-(4-bromophenyl)-2-methylpropanoate?
The InChIKey is FTUVBAYUPFNMED-RFVHGSKJSA-N. The full InChI is InChI=1S/C11H14BrNO2.CHNO/c1-11(13,10(14)15-2)7-8-3-5-9(12)6-4-8;2-1-3/h3-6H,7,13H2,1-2H3;2H/t11-;/m1./s1.
What are the key properties of isocyanic acid;methyl (2R)-2-amino-3-(4-bromophenyl)-2-methylpropanoate?
isocyanic acid;methyl (2R)-2-amino-3-(4-bromophenyl)-2-methylpropanoate has a molecular weight of 315.17 g/mol, XLogP of 1.78, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for isocyanic acid;methyl (2R)-2-amino-3-(4-bromophenyl)-2-methylpropanoate is sourced from PubChem (CID 172715255), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).