C12H13BrO5 — CID 58354452
2-[(4-bromophenyl)methoxy]-3-methoxy-2-methyl-3-oxopropanoic acid (PubChem CID 58354452) has the molecular formula C12H13BrO5 and a molecular weight of 317.13 g/mol. Its IUPAC name is 2-[(4-bromophenyl)methoxy]-3-methoxy-2-methyl-3-oxopropanoic acid.
| Compound Name | 2-[(4-bromophenyl)methoxy]-3-methoxy-2-methyl-3-oxopropanoic acid |
|---|---|
| PubChem CID | 58354452 |
| Molecular Formula | C12H13BrO5 |
| Molecular Weight | 317.13 g/mol |
| Exact Mass | 315.99 |
| IUPAC Name | 2-[(4-bromophenyl)methoxy]-3-methoxy-2-methyl-3-oxopropanoic acid |
| SMILES | COC(=O)C(C)(OCc1ccc(Br)cc1)C(=O)O |
| InChI | InChI=1S/C12H13BrO5/c1-12(10(14)15,11(16)17-2)18-7-8-3-5-9(13)6-4-8/h3-6H,7H2,1-2H3,(H,14,15) |
| InChIKey | GDTFJXPSBYOMGR-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.13 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|