C25H23BrO6 — CID 102391882
dimethyl 2-(4-bromophenyl)-2-hydroxy-3-phenyl-3-phenylmethoxybutanedioate (PubChem CID 102391882) has the molecular formula C25H23BrO6 and a molecular weight of 499.36 g/mol. Its IUPAC name is dimethyl 2-(4-bromophenyl)-2-hydroxy-3-phenyl-3-phenylmethoxybutanedioate.
| Compound Name | dimethyl 2-(4-bromophenyl)-2-hydroxy-3-phenyl-3-phenylmethoxybutanedioate |
|---|---|
| PubChem CID | 102391882 |
| Molecular Formula | C25H23BrO6 |
| Molecular Weight | 499.36 g/mol |
| Exact Mass | 498.07 |
| IUPAC Name | dimethyl 2-(4-bromophenyl)-2-hydroxy-3-phenyl-3-phenylmethoxybutanedioate |
| SMILES | COC(=O)C(O)(c1ccc(Br)cc1)C(OCc1ccccc1)(C(=O)OC)c1ccccc1 |
| InChI | InChI=1S/C25H23BrO6/c1-30-22(27)24(29,19-13-15-21(26)16-14-19)25(23(28)31-2,20-11-7-4-8-12-20)32-17-18-9-5-3-6-10-18/h3-16,29H,17H2,1-2H3 |
| InChIKey | CCPKIGPXSFNXJB-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.36 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |