azane;N-chlorosulfonylsulfamoyl chloride

H4Cl2N2O4S2 — CID 172715713

IUPACazane;N-chlorosulfonylsulfamoyl chloride
SMILESN.O=S(=O)(Cl)NS(=O)(=O)Cl
InChIInChI=1S/Cl2HNO4S2.H3N/c1-8(4,5)3-9(2,6)7;/h3H;1H3
InChIKeyFVJATCFXORFHRI-UHFFFAOYSA-N
MW231.08 g/mol
LogP-0.29
Rot. Bonds2

About azane;N-chlorosulfonylsulfamoyl chloride

azane;N-chlorosulfonylsulfamoyl chloride (PubChem CID 172715713) has the molecular formula H4Cl2N2O4S2 and a molecular weight of 231.08 g/mol. Its IUPAC name is azane;N-chlorosulfonylsulfamoyl chloride.

Molecular Properties

Compound Nameazane;N-chlorosulfonylsulfamoyl chloride
PubChem CID172715713
Molecular FormulaH4Cl2N2O4S2
Molecular Weight231.08 g/mol
Exact Mass229.90
IUPAC Nameazane;N-chlorosulfonylsulfamoyl chloride
SMILESN.O=S(=O)(Cl)NS(=O)(=O)Cl
InChIInChI=1S/Cl2HNO4S2.H3N/c1-8(4,5)3-9(2,6)7;/h3H;1H3
InChIKeyFVJATCFXORFHRI-UHFFFAOYSA-N
XLogP-0.29
TPSA115.31 Ų
H-Bond Donors2
H-Bond Acceptors5
Rotatable Bonds2
Heavy Atoms10
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500231.08
LogP ≤ 5-0.29
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 105

Analyze azane;N-chlorosulfonylsulfamoyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of azane;N-chlorosulfonylsulfamoyl chloride?
The IUPAC name of azane;N-chlorosulfonylsulfamoyl chloride (CID 172715713) is azane;N-chlorosulfonylsulfamoyl chloride.
What is the SMILES notation for azane;N-chlorosulfonylsulfamoyl chloride?
The canonical SMILES for azane;N-chlorosulfonylsulfamoyl chloride is N.O=S(=O)(Cl)NS(=O)(=O)Cl.
What is the InChIKey of azane;N-chlorosulfonylsulfamoyl chloride?
The InChIKey is FVJATCFXORFHRI-UHFFFAOYSA-N. The full InChI is InChI=1S/Cl2HNO4S2.H3N/c1-8(4,5)3-9(2,6)7;/h3H;1H3.
What are the key properties of azane;N-chlorosulfonylsulfamoyl chloride?
azane;N-chlorosulfonylsulfamoyl chloride has a molecular weight of 231.08 g/mol, XLogP of -0.29, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for azane;N-chlorosulfonylsulfamoyl chloride is sourced from PubChem (CID 172715713), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).