C20H22N6S — CID 172717463
N'-[[4-(2-aminopyrimidin-4-yl)-2-methylphenyl]methyl]-4,5,6,7-tetrahydrothieno[2,3-c]pyridine-2-carboximidamide (PubChem CID 172717463) has the molecular formula C20H22N6S and a molecular weight of 378.51 g/mol. Its IUPAC name is N'-[[4-(2-aminopyrimidin-4-yl)-2-methylphenyl]methyl]-4,5,6,7-tetrahydrothieno[2,3-c]pyridine-2-carboximidamide.
| Compound Name | N'-[[4-(2-aminopyrimidin-4-yl)-2-methylphenyl]methyl]-4,5,6,7-tetrahydrothieno[2,3-c]pyridine-2-carboximidamide |
|---|---|
| PubChem CID | 172717463 |
| Molecular Formula | C20H22N6S |
| Molecular Weight | 378.51 g/mol |
| Exact Mass | 378.16 |
| IUPAC Name | N'-[[4-(2-aminopyrimidin-4-yl)-2-methylphenyl]methyl]-4,5,6,7-tetrahydrothieno[2,3-c]pyridine-2-carboximidamide |
| SMILES | Cc1cc(-c2ccnc(N)n2)ccc1C/N=C(\N)c1cc2c(s1)CNCC2 |
| InChI | InChI=1S/C20H22N6S/c1-12-8-13(16-5-7-24-20(22)26-16)2-3-15(12)10-25-19(21)17-9-14-4-6-23-11-18(14)27-17/h2-3,5,7-9,23H,4,6,10-11H2,1H3,(H2,21,25)(H2,22,24,26) |
| InChIKey | GBDRHOLCTMCMAO-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 102.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.51 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|