C5H5NO4S — CID 172718868
1-carboxy-2H-1,3-thiazol-1-ium-3-carboxylate (PubChem CID 172718868) has the molecular formula C5H5NO4S and a molecular weight of 175.17 g/mol. Its IUPAC name is 1-carboxy-2H-1,3-thiazol-1-ium-3-carboxylate.
| Compound Name | 1-carboxy-2H-1,3-thiazol-1-ium-3-carboxylate |
|---|---|
| PubChem CID | 172718868 |
| Molecular Formula | C5H5NO4S |
| Molecular Weight | 175.17 g/mol |
| Exact Mass | 174.99 |
| IUPAC Name | 1-carboxy-2H-1,3-thiazol-1-ium-3-carboxylate |
| SMILES | O=C([O-])N1C=C[S+](C(=O)O)C1 |
| InChI | InChI=1S/C5H5NO4S/c7-4(8)6-1-2-11(3-6)5(9)10/h1-2H,3H2,(H-,7,8,9,10) |
| InChIKey | GFQDSWLHHARSLQ-UHFFFAOYSA-N |
| XLogP | -0.63 |
| TPSA | 80.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.17 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|