C5H6NO4S+ — CID 172718869
2H-1,3-thiazol-1-ium-1,3-dicarboxylic acid (PubChem CID 172718869) has the molecular formula C5H6NO4S+ and a molecular weight of 176.17 g/mol. Its IUPAC name is 2H-1,3-thiazol-1-ium-1,3-dicarboxylic acid.
| Compound Name | 2H-1,3-thiazol-1-ium-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 172718869 |
| Molecular Formula | C5H6NO4S+ |
| Molecular Weight | 176.17 g/mol |
| Exact Mass | 176.00 |
| IUPAC Name | 2H-1,3-thiazol-1-ium-1,3-dicarboxylic acid |
| SMILES | O=C(O)N1C=C[S+](C(=O)O)C1 |
| InChI | InChI=1S/C5H5NO4S/c7-4(8)6-1-2-11(3-6)5(9)10/h1-2H,3H2,(H-,7,8,9,10)/p+1 |
| InChIKey | GFQDSWLHHARSLQ-UHFFFAOYSA-O |
| XLogP | 0.70 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.17 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|