C25H37Cl3N3O4S+ — CID 172719068
[3-[4-[2-(4-chlorophenyl)ethyl]piperazin-1-yl]propylsulfanyl-hydroxymethylidene]-(3,4,5-trimethoxyphenyl)azanium;dihydrochloride (PubChem CID 172719068) has the molecular formula C25H37Cl3N3O4S+ and a molecular weight of 582.01 g/mol. Its IUPAC name is [3-[4-[2-(4-chlorophenyl)ethyl]piperazin-1-yl]propylsulfanyl-hydroxymethylidene]-(3,4,5-trimethoxyphenyl)azanium;dihydrochloride.
| Compound Name | [3-[4-[2-(4-chlorophenyl)ethyl]piperazin-1-yl]propylsulfanyl-hydroxymethylidene]-(3,4,5-trimethoxyphenyl)azanium;dihydrochloride |
|---|---|
| PubChem CID | 172719068 |
| Molecular Formula | C25H37Cl3N3O4S+ |
| Molecular Weight | 582.01 g/mol |
| Exact Mass | 580.16 |
| IUPAC Name | [3-[4-[2-(4-chlorophenyl)ethyl]piperazin-1-yl]propylsulfanyl-hydroxymethylidene]-(3,4,5-trimethoxyphenyl)azanium;dihydrochloride |
| SMILES | COc1cc(/[NH+]=C(\O)SCCCN2CCN(CCc3ccc(Cl)cc3)CC2)cc(OC)c1OC.Cl.Cl |
| InChI | InChI=1S/C25H34ClN3O4S.2ClH/c1-31-22-17-21(18-23(32-2)24(22)33-3)27-25(30)34-16-4-10-28-12-14-29(15-13-28)11-9-19-5-7-20(26)8-6-19;;/h5-8,17-18H,4,9-16H2,1-3H3,(H,27,30);2*1H/p+1 |
| InChIKey | RMGUORASGAZJMK-UHFFFAOYSA-O |
| XLogP | 3.82 |
| TPSA | 68.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.01 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|