About 5-O-ethyl 1-O-methyl 2-ethoxypentanedioate
5-O-ethyl 1-O-methyl 2-ethoxypentanedioate (PubChem CID 172723859) has the molecular formula C10H18O5
and a molecular weight of 218.25 g/mol. Its IUPAC name is 5-O-ethyl 1-O-methyl 2-ethoxypentanedioate.
Molecular Properties
| Compound Name | 5-O-ethyl 1-O-methyl 2-ethoxypentanedioate |
| PubChem CID | 172723859 |
| Molecular Formula | C10H18O5 |
| Molecular Weight | 218.25 g/mol |
| Exact Mass | 218.12 |
| IUPAC Name | 5-O-ethyl 1-O-methyl 2-ethoxypentanedioate |
| SMILES | CCOC(=O)CCC(OCC)C(=O)OC |
| InChI | InChI=1S/C10H18O5/c1-4-14-8(10(12)13-3)6-7-9(11)15-5-2/h8H,4-7H2,1-3H3 |
| InChIKey | GWMJGNZLIZZILP-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.25 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-O-ethyl 1-O-methyl 2-ethoxypentanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-O-ethyl 1-O-methyl 2-ethoxypentanedioate?
The IUPAC name of 5-O-ethyl 1-O-methyl 2-ethoxypentanedioate (CID 172723859) is 5-O-ethyl 1-O-methyl 2-ethoxypentanedioate.
What is the SMILES notation for 5-O-ethyl 1-O-methyl 2-ethoxypentanedioate?
The canonical SMILES for 5-O-ethyl 1-O-methyl 2-ethoxypentanedioate is CCOC(=O)CCC(OCC)C(=O)OC.
What is the InChIKey of 5-O-ethyl 1-O-methyl 2-ethoxypentanedioate?
The InChIKey is GWMJGNZLIZZILP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18O5/c1-4-14-8(10(12)13-3)6-7-9(11)15-5-2/h8H,4-7H2,1-3H3.
What are the key properties of 5-O-ethyl 1-O-methyl 2-ethoxypentanedioate?
5-O-ethyl 1-O-methyl 2-ethoxypentanedioate has a molecular weight of 218.25 g/mol, XLogP of 0.91, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-O-ethyl 1-O-methyl 2-ethoxypentanedioate is sourced from PubChem (CID 172723859), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).