C10H16N6O4 — CID 172729988
oxaldehyde;pentanedial;1,3,5-triazine-2,4,6-triamine (PubChem CID 172729988) has the molecular formula C10H16N6O4 and a molecular weight of 284.28 g/mol. Its IUPAC name is oxaldehyde;pentanedial;1,3,5-triazine-2,4,6-triamine.
| Compound Name | oxaldehyde;pentanedial;1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 172729988 |
| Molecular Formula | C10H16N6O4 |
| Molecular Weight | 284.28 g/mol |
| Exact Mass | 284.12 |
| IUPAC Name | oxaldehyde;pentanedial;1,3,5-triazine-2,4,6-triamine |
| SMILES | Nc1nc(N)nc(N)n1.O=CC=O.O=CCCCC=O |
| InChI | InChI=1S/C5H8O2.C3H6N6.C2H2O2/c6-4-2-1-3-5-7;4-1-7-2(5)9-3(6)8-1;3-1-2-4/h4-5H,1-3H2;(H6,4,5,6,7,8,9);1-2H |
| InChIKey | HQWMFRCZZMHQFJ-UHFFFAOYSA-N |
| XLogP | -1.44 |
| TPSA | 185.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.28 |
| LogP ≤ 5 | -1.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|