C40H56O2 — CID 172730477
4,4,7a-trimethyl-2-[(2E,4E,6E,8E)-6,11,15-trimethyl-17-(2,2,6-trimethyl-7-oxabicyclo[4.1.0]heptan-1-yl)heptadeca-2,4,6,8,10,12,14,16-octaen-2-yl]-2,5,6,7-tetrahydro-1-benzofuran (PubChem CID 172730477) has the molecular formula C40H56O2 and a molecular weight of 568.89 g/mol. Its IUPAC name is 4,4,7a-trimethyl-2-[(2E,4E,6E,8E)-6,11,15-trimethyl-17-(2,2,6-trimethyl-7-oxabicyclo[4.1.0]heptan-1-yl)heptadeca-2,4,6,8,10,12,14,16-octaen-2-yl]-2,5,6,7-tetrahydro-1-benzofuran.
| Compound Name | 4,4,7a-trimethyl-2-[(2E,4E,6E,8E)-6,11,15-trimethyl-17-(2,2,6-trimethyl-7-oxabicyclo[4.1.0]heptan-1-yl)heptadeca-2,4,6,8,10,12,14,16-octaen-2-yl]-2,5,6,7-tetrahydro-1-benzofuran |
|---|---|
| PubChem CID | 172730477 |
| Molecular Formula | C40H56O2 |
| Molecular Weight | 568.89 g/mol |
| Exact Mass | 568.43 |
| IUPAC Name | 4,4,7a-trimethyl-2-[(2E,4E,6E,8E)-6,11,15-trimethyl-17-(2,2,6-trimethyl-7-oxabicyclo[4.1.0]heptan-1-yl)heptadeca-2,4,6,8,10,12,14,16-octaen-2-yl]-2,5,6,7-tetrahydro-1-benzofuran |
| SMILES | CC(C=CC12OC1(C)CCCC2(C)C)=CC=CC(C)=C/C=C/C=C(C)/C=C/C=C(\C)C1C=C2C(C)(C)CCCC2(C)O1 |
| InChI | InChI=1S/C40H56O2/c1-30(19-13-20-32(3)23-28-40-37(7,8)25-16-27-39(40,10)42-40)17-11-12-18-31(2)21-14-22-33(4)34-29-35-36(5,6)24-15-26-38(35,9)41-34/h11-14,17-23,28-29,34H,15-16,24-27H2,1-10H3/b12-11+,19-13?,21-14+,28-23?,30-17?,31-18+,32-20?,33-22+ |
| InChIKey | HSOIPJLINDKQOV-IGSIHSMMSA-N |
| XLogP | 11.03 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.89 |
| LogP ≤ 5 | 11.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|