C22H30O2 — CID 101001293
(2E,4E,6E,8E)-9-(4,4,7a-trimethyl-2,5,6,7-tetrahydro-1-benzofuran-2-yl)-5-methyldeca-2,4,6,8-tetraenal (PubChem CID 101001293) has the molecular formula C22H30O2 and a molecular weight of 326.48 g/mol. Its IUPAC name is (2E,4E,6E,8E)-9-(4,4,7a-trimethyl-2,5,6,7-tetrahydro-1-benzofuran-2-yl)-5-methyldeca-2,4,6,8-tetraenal.
| Compound Name | (2E,4E,6E,8E)-9-(4,4,7a-trimethyl-2,5,6,7-tetrahydro-1-benzofuran-2-yl)-5-methyldeca-2,4,6,8-tetraenal |
|---|---|
| PubChem CID | 101001293 |
| Molecular Formula | C22H30O2 |
| Molecular Weight | 326.48 g/mol |
| Exact Mass | 326.22 |
| IUPAC Name | (2E,4E,6E,8E)-9-(4,4,7a-trimethyl-2,5,6,7-tetrahydro-1-benzofuran-2-yl)-5-methyldeca-2,4,6,8-tetraenal |
| SMILES | CC(/C=C/C=C(\C)C1C=C2C(C)(C)CCCC2(C)O1)=C\C=C\C=O |
| InChI | InChI=1S/C22H30O2/c1-17(10-6-7-15-23)11-8-12-18(2)19-16-20-21(3,4)13-9-14-22(20,5)24-19/h6-8,10-12,15-16,19H,9,13-14H2,1-5H3/b7-6+,11-8+,17-10+,18-12+ |
| InChIKey | DMRSORNMVZSMKM-HSYVJJFISA-N |
| XLogP | 5.48 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.48 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|