C21H30O3 — CID 177463639
methyl (2Z,4Z,6E)-7-[(2R,7aR)-4,4,7a-trimethyl-2,5,6,7-tetrahydro-1-benzofuran-2-yl]-3-methylocta-2,4,6-trienoate (PubChem CID 177463639) has the molecular formula C21H30O3 and a molecular weight of 330.47 g/mol. Its IUPAC name is methyl (2Z,4Z,6E)-7-[(2R,7aR)-4,4,7a-trimethyl-2,5,6,7-tetrahydro-1-benzofuran-2-yl]-3-methylocta-2,4,6-trienoate.
| Compound Name | methyl (2Z,4Z,6E)-7-[(2R,7aR)-4,4,7a-trimethyl-2,5,6,7-tetrahydro-1-benzofuran-2-yl]-3-methylocta-2,4,6-trienoate |
|---|---|
| PubChem CID | 177463639 |
| Molecular Formula | C21H30O3 |
| Molecular Weight | 330.47 g/mol |
| Exact Mass | 330.22 |
| IUPAC Name | methyl (2Z,4Z,6E)-7-[(2R,7aR)-4,4,7a-trimethyl-2,5,6,7-tetrahydro-1-benzofuran-2-yl]-3-methylocta-2,4,6-trienoate |
| SMILES | COC(=O)/C=C(C)\C=C/C=C(\C)[C@H]1C=C2C(C)(C)CCC[C@@]2(C)O1 |
| InChI | InChI=1S/C21H30O3/c1-15(13-19(22)23-6)9-7-10-16(2)17-14-18-20(3,4)11-8-12-21(18,5)24-17/h7,9-10,13-14,17H,8,11-12H2,1-6H3/b9-7-,15-13-,16-10+/t17-,21-/m1/s1 |
| InChIKey | KSJHZRVANAEYPS-YWIWXYPQSA-N |
| XLogP | 4.90 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.47 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|