About chloro hypochlorite;N,N-dimethylmethanamine;sulfane
chloro hypochlorite;N,N-dimethylmethanamine;sulfane (PubChem CID 172730513) has the molecular formula C3H11Cl2NOS
and a molecular weight of 180.10 g/mol. Its IUPAC name is chloro hypochlorite;N,N-dimethylmethanamine;sulfane.
Molecular Properties
| Compound Name | chloro hypochlorite;N,N-dimethylmethanamine;sulfane |
| PubChem CID | 172730513 |
| Molecular Formula | C3H11Cl2NOS |
| Molecular Weight | 180.10 g/mol |
| Exact Mass | 178.99 |
| IUPAC Name | chloro hypochlorite;N,N-dimethylmethanamine;sulfane |
| SMILES | CN(C)C.ClOCl.S |
| InChI | InChI=1S/C3H9N.Cl2O.H2S/c1-4(2)3;1-3-2;/h1-3H3;;1H2 |
| InChIKey | HSRLFVZVWDUEAN-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.10 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze chloro hypochlorite;N,N-dimethylmethanamine;sulfane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chloro hypochlorite;N,N-dimethylmethanamine;sulfane?
The IUPAC name of chloro hypochlorite;N,N-dimethylmethanamine;sulfane (CID 172730513) is chloro hypochlorite;N,N-dimethylmethanamine;sulfane.
What is the SMILES notation for chloro hypochlorite;N,N-dimethylmethanamine;sulfane?
The canonical SMILES for chloro hypochlorite;N,N-dimethylmethanamine;sulfane is CN(C)C.ClOCl.S.
What is the InChIKey of chloro hypochlorite;N,N-dimethylmethanamine;sulfane?
The InChIKey is HSRLFVZVWDUEAN-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H9N.Cl2O.H2S/c1-4(2)3;1-3-2;/h1-3H3;;1H2.
What are the key properties of chloro hypochlorite;N,N-dimethylmethanamine;sulfane?
chloro hypochlorite;N,N-dimethylmethanamine;sulfane has a molecular weight of 180.10 g/mol, XLogP of 1.60, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for chloro hypochlorite;N,N-dimethylmethanamine;sulfane is sourced from PubChem (CID 172730513), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).