C32H37Cl2F2N3O3 — CID 172731255
methyl 2-[[[(2R,3S,4R,5S)-3-(3-chloro-2-fluorophenyl)-4-(4-chloro-2-fluorophenyl)-4-cyano-5-(2,2-dimethylpropyl)pyrrolidine-2-carbonyl]amino]methyl]cyclohexane-1-carboxylate (PubChem CID 172731255) has the molecular formula C32H37Cl2F2N3O3 and a molecular weight of 620.57 g/mol. Its IUPAC name is methyl 2-[[[(2R,3S,4R,5S)-3-(3-chloro-2-fluorophenyl)-4-(4-chloro-2-fluorophenyl)-4-cyano-5-(2,2-dimethylpropyl)pyrrolidine-2-carbonyl]amino]methyl]cyclohexane-1-carboxylate.
| Compound Name | methyl 2-[[[(2R,3S,4R,5S)-3-(3-chloro-2-fluorophenyl)-4-(4-chloro-2-fluorophenyl)-4-cyano-5-(2,2-dimethylpropyl)pyrrolidine-2-carbonyl]amino]methyl]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 172731255 |
| Molecular Formula | C32H37Cl2F2N3O3 |
| Molecular Weight | 620.57 g/mol |
| Exact Mass | 619.22 |
| IUPAC Name | methyl 2-[[[(2R,3S,4R,5S)-3-(3-chloro-2-fluorophenyl)-4-(4-chloro-2-fluorophenyl)-4-cyano-5-(2,2-dimethylpropyl)pyrrolidine-2-carbonyl]amino]methyl]cyclohexane-1-carboxylate |
| SMILES | COC(=O)C1CCCCC1CNC(=O)[C@@H]1N[C@@H](CC(C)(C)C)[C@](C#N)(c2ccc(Cl)cc2F)[C@H]1c1cccc(Cl)c1F |
| InChI | InChI=1S/C32H37Cl2F2N3O3/c1-31(2,3)15-25-32(17-37,22-13-12-19(33)14-24(22)35)26(21-10-7-11-23(34)27(21)36)28(39-25)29(40)38-16-18-8-5-6-9-20(18)30(41)42-4/h7,10-14,18,20,25-26,28,39H,5-6,8-9,15-16H2,1-4H3,(H,38,40)/t18?,20?,25-,26-,28+,32-/m0/s1 |
| InChIKey | HVAOLSQXFOQANV-IYDGCYCJSA-N |
| XLogP | 6.69 |
| TPSA | 91.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.57 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |