C11H8FNO2 — CID 172734793
2-fluoro-2,3-dihydro-[1,4]dioxino[2,3-h]quinoline (PubChem CID 172734793) has the molecular formula C11H8FNO2 and a molecular weight of 205.19 g/mol. Its IUPAC name is 2-fluoro-2,3-dihydro-[1,4]dioxino[2,3-h]quinoline.
| Compound Name | 2-fluoro-2,3-dihydro-[1,4]dioxino[2,3-h]quinoline |
|---|---|
| PubChem CID | 172734793 |
| Molecular Formula | C11H8FNO2 |
| Molecular Weight | 205.19 g/mol |
| Exact Mass | 205.05 |
| IUPAC Name | 2-fluoro-2,3-dihydro-[1,4]dioxino[2,3-h]quinoline |
| SMILES | FC1COc2ccc3cccnc3c2O1 |
| InChI | InChI=1S/C11H8FNO2/c12-9-6-14-8-4-3-7-2-1-5-13-10(7)11(8)15-9/h1-5,9H,6H2 |
| InChIKey | IHBBUOAYWUCTME-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.19 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |