About [2,6-dimethyl-6-(6-methyl-2-oxo-3H-benzimidazol-1-yl)heptan-2-yl] carbamate
[2,6-dimethyl-6-(6-methyl-2-oxo-3H-benzimidazol-1-yl)heptan-2-yl] carbamate (PubChem CID 172737757) has the molecular formula C18H27N3O3
and a molecular weight of 333.43 g/mol. Its IUPAC name is [2,6-dimethyl-6-(6-methyl-2-oxo-3H-benzimidazol-1-yl)heptan-2-yl] carbamate.
Molecular Properties
| Compound Name | [2,6-dimethyl-6-(6-methyl-2-oxo-3H-benzimidazol-1-yl)heptan-2-yl] carbamate |
| PubChem CID | 172737757 |
| Molecular Formula | C18H27N3O3 |
| Molecular Weight | 333.43 g/mol |
| Exact Mass | 333.21 |
| IUPAC Name | [2,6-dimethyl-6-(6-methyl-2-oxo-3H-benzimidazol-1-yl)heptan-2-yl] carbamate |
| SMILES | Cc1ccc2[nH]c(=O)n(C(C)(C)CCCC(C)(C)OC(N)=O)c2c1 |
| InChI | InChI=1S/C18H27N3O3/c1-12-7-8-13-14(11-12)21(16(23)20-13)17(2,3)9-6-10-18(4,5)24-15(19)22/h7-8,11H,6,9-10H2,1-5H3,(H2,19,22)(H,20,23) |
| InChIKey | IREJSDLROHNTAQ-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 90.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.43 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [2,6-dimethyl-6-(6-methyl-2-oxo-3H-benzimidazol-1-yl)heptan-2-yl] carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2,6-dimethyl-6-(6-methyl-2-oxo-3H-benzimidazol-1-yl)heptan-2-yl] carbamate?
The IUPAC name of [2,6-dimethyl-6-(6-methyl-2-oxo-3H-benzimidazol-1-yl)heptan-2-yl] carbamate (CID 172737757) is [2,6-dimethyl-6-(6-methyl-2-oxo-3H-benzimidazol-1-yl)heptan-2-yl] carbamate.
What is the SMILES notation for [2,6-dimethyl-6-(6-methyl-2-oxo-3H-benzimidazol-1-yl)heptan-2-yl] carbamate?
The canonical SMILES for [2,6-dimethyl-6-(6-methyl-2-oxo-3H-benzimidazol-1-yl)heptan-2-yl] carbamate is Cc1ccc2[nH]c(=O)n(C(C)(C)CCCC(C)(C)OC(N)=O)c2c1.
What is the InChIKey of [2,6-dimethyl-6-(6-methyl-2-oxo-3H-benzimidazol-1-yl)heptan-2-yl] carbamate?
The InChIKey is IREJSDLROHNTAQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H27N3O3/c1-12-7-8-13-14(11-12)21(16(23)20-13)17(2,3)9-6-10-18(4,5)24-15(19)22/h7-8,11H,6,9-10H2,1-5H3,(H2,19,22)(H,20,23).
What are the key properties of [2,6-dimethyl-6-(6-methyl-2-oxo-3H-benzimidazol-1-yl)heptan-2-yl] carbamate?
[2,6-dimethyl-6-(6-methyl-2-oxo-3H-benzimidazol-1-yl)heptan-2-yl] carbamate has a molecular weight of 333.43 g/mol, XLogP of 3.42, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2,6-dimethyl-6-(6-methyl-2-oxo-3H-benzimidazol-1-yl)heptan-2-yl] carbamate is sourced from PubChem (CID 172737757), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).