C13H11Cl2F2N3NaO4S — CID 172740989
CID 172740989 (PubChem CID 172740989) has the molecular formula C13H11Cl2F2N3NaO4S and a molecular weight of 437.21 g/mol.
| Compound Name | CID 172740989 |
|---|---|
| PubChem CID | 172740989 |
| Molecular Formula | C13H11Cl2F2N3NaO4S |
| Molecular Weight | 437.21 g/mol |
| Exact Mass | 435.97 |
| IUPAC Name | — |
| SMILES | O=C1[C@H]2C[C@H](F)CN2C(=O)N1c1cc(NS(=O)(=O)CCl)c(Cl)cc1F.[Na] |
| InChI | InChI=1S/C13H11Cl2F2N3O4S.Na/c14-5-25(23,24)18-9-3-10(8(17)2-7(9)15)20-12(21)11-1-6(16)4-19(11)13(20)22;/h2-3,6,11,18H,1,4-5H2;/t6-,11+;/m0./s1 |
| InChIKey | JCEDYDUSNDGURT-DDHIQJLISA-N |
| XLogP | 1.92 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.21 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|