C15H18O2 — CID 172743477
6-[(1E,3R)-3-methylhexa-1,5-dienyl]-2,3-dihydro-1,4-benzodioxine (PubChem CID 172743477) has the molecular formula C15H18O2 and a molecular weight of 230.31 g/mol. Its IUPAC name is 6-[(1E,3R)-3-methylhexa-1,5-dienyl]-2,3-dihydro-1,4-benzodioxine.
| Compound Name | 6-[(1E,3R)-3-methylhexa-1,5-dienyl]-2,3-dihydro-1,4-benzodioxine |
|---|---|
| PubChem CID | 172743477 |
| Molecular Formula | C15H18O2 |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.13 |
| IUPAC Name | 6-[(1E,3R)-3-methylhexa-1,5-dienyl]-2,3-dihydro-1,4-benzodioxine |
| SMILES | C=CC[C@@H](C)/C=C/c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C15H18O2/c1-3-4-12(2)5-6-13-7-8-14-15(11-13)17-10-9-16-14/h3,5-8,11-12H,1,4,9-10H2,2H3/b6-5+/t12-/m1/s1 |
| InChIKey | JKGHBWAFEBVQOB-BTDICHCPSA-N |
| XLogP | 3.68 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|