C13H11N3OS — CID 172745227
10H-pyrido[1,2-b][1,2,5]benzothiadiazepine-9-carboxamide (PubChem CID 172745227) has the molecular formula C13H11N3OS and a molecular weight of 257.32 g/mol. Its IUPAC name is 10H-pyrido[1,2-b][1,2,5]benzothiadiazepine-9-carboxamide.
| Compound Name | 10H-pyrido[1,2-b][1,2,5]benzothiadiazepine-9-carboxamide |
|---|---|
| PubChem CID | 172745227 |
| Molecular Formula | C13H11N3OS |
| Molecular Weight | 257.32 g/mol |
| Exact Mass | 257.06 |
| IUPAC Name | 10H-pyrido[1,2-b][1,2,5]benzothiadiazepine-9-carboxamide |
| SMILES | NC(=O)C1=CC=C2C=Nc3ccccc3SN2C1 |
| InChI | InChI=1S/C13H11N3OS/c14-13(17)9-5-6-10-7-15-11-3-1-2-4-12(11)18-16(10)8-9/h1-7H,8H2,(H2,14,17) |
| InChIKey | JQAHMCVGCSIQDB-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 58.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.32 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|