C33H54N4O9 — CID 172747346
ethyl N-[4-[(2-amino-1,1-dicyclohexyl-2-oxoethyl)-[3-(diethylamino)propyl]carbamoyl]phenyl]carbamate;oxalic acid;hydrate (PubChem CID 172747346) has the molecular formula C33H54N4O9 and a molecular weight of 650.81 g/mol. Its IUPAC name is ethyl N-[4-[(2-amino-1,1-dicyclohexyl-2-oxoethyl)-[3-(diethylamino)propyl]carbamoyl]phenyl]carbamate;oxalic acid;hydrate.
| Compound Name | ethyl N-[4-[(2-amino-1,1-dicyclohexyl-2-oxoethyl)-[3-(diethylamino)propyl]carbamoyl]phenyl]carbamate;oxalic acid;hydrate |
|---|---|
| PubChem CID | 172747346 |
| Molecular Formula | C33H54N4O9 |
| Molecular Weight | 650.81 g/mol |
| Exact Mass | 650.39 |
| IUPAC Name | ethyl N-[4-[(2-amino-1,1-dicyclohexyl-2-oxoethyl)-[3-(diethylamino)propyl]carbamoyl]phenyl]carbamate;oxalic acid;hydrate |
| SMILES | CCOC(=O)Nc1ccc(C(=O)N(CCCN(CC)CC)C(C(N)=O)(C2CCCCC2)C2CCCCC2)cc1.O.O=C(O)C(=O)O |
| InChI | InChI=1S/C31H50N4O4.C2H2O4.H2O/c1-4-34(5-2)22-13-23-35(28(36)24-18-20-27(21-19-24)33-30(38)39-6-3)31(29(32)37,25-14-9-7-10-15-25)26-16-11-8-12-17-26;3-1(4)2(5)6;/h18-21,25-26H,4-17,22-23H2,1-3H3,(H2,32,37)(H,33,38);(H,3,4)(H,5,6);1H2 |
| InChIKey | JXCQMUIAJGSQAE-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 211.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.81 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|