C14H17N3O3S — CID 172747956
N-[3-(1,5-dimethyl-4-oxopyridazin-3-yl)phenyl]ethanesulfonamide (PubChem CID 172747956) has the molecular formula C14H17N3O3S and a molecular weight of 307.38 g/mol. Its IUPAC name is N-[3-(1,5-dimethyl-4-oxopyridazin-3-yl)phenyl]ethanesulfonamide.
| Compound Name | N-[3-(1,5-dimethyl-4-oxopyridazin-3-yl)phenyl]ethanesulfonamide |
|---|---|
| PubChem CID | 172747956 |
| Molecular Formula | C14H17N3O3S |
| Molecular Weight | 307.38 g/mol |
| Exact Mass | 307.10 |
| IUPAC Name | N-[3-(1,5-dimethyl-4-oxopyridazin-3-yl)phenyl]ethanesulfonamide |
| SMILES | CCS(=O)(=O)Nc1cccc(-c2nn(C)cc(C)c2=O)c1 |
| InChI | InChI=1S/C14H17N3O3S/c1-4-21(19,20)16-12-7-5-6-11(8-12)13-14(18)10(2)9-17(3)15-13/h5-9,16H,4H2,1-3H3 |
| InChIKey | JZCUCKHOOIBLEL-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 81.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.38 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |