C20H19N3O5S — CID 71541962
4-[4-[3-(ethylsulfonylamino)phenyl]-3-methyl-6-oxopyridazin-1-yl]benzoic acid (PubChem CID 71541962) has the molecular formula C20H19N3O5S and a molecular weight of 413.46 g/mol. Its IUPAC name is 4-[4-[3-(ethylsulfonylamino)phenyl]-3-methyl-6-oxopyridazin-1-yl]benzoic acid.
| Compound Name | 4-[4-[3-(ethylsulfonylamino)phenyl]-3-methyl-6-oxopyridazin-1-yl]benzoic acid |
|---|---|
| PubChem CID | 71541962 |
| Molecular Formula | C20H19N3O5S |
| Molecular Weight | 413.46 g/mol |
| Exact Mass | 413.10 |
| IUPAC Name | 4-[4-[3-(ethylsulfonylamino)phenyl]-3-methyl-6-oxopyridazin-1-yl]benzoic acid |
| SMILES | CCS(=O)(=O)Nc1cccc(-c2cc(=O)n(-c3ccc(C(=O)O)cc3)nc2C)c1 |
| InChI | InChI=1S/C20H19N3O5S/c1-3-29(27,28)22-16-6-4-5-15(11-16)18-12-19(24)23(21-13(18)2)17-9-7-14(8-10-17)20(25)26/h4-12,22H,3H2,1-2H3,(H,25,26) |
| InChIKey | WGPIZRPYTQZPAG-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 118.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.46 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |