C25H24N6O2S2 — CID 121367268
N-[3-[1,6-dimethyl-5-[(4-pyridin-4-yl-1,3-thiazol-2-yl)amino]benzimidazol-2-yl]phenyl]ethanesulfonamide (PubChem CID 121367268) has the molecular formula C25H24N6O2S2 and a molecular weight of 504.64 g/mol. Its IUPAC name is N-[3-[1,6-dimethyl-5-[(4-pyridin-4-yl-1,3-thiazol-2-yl)amino]benzimidazol-2-yl]phenyl]ethanesulfonamide.
| Compound Name | N-[3-[1,6-dimethyl-5-[(4-pyridin-4-yl-1,3-thiazol-2-yl)amino]benzimidazol-2-yl]phenyl]ethanesulfonamide |
|---|---|
| PubChem CID | 121367268 |
| Molecular Formula | C25H24N6O2S2 |
| Molecular Weight | 504.64 g/mol |
| Exact Mass | 504.14 |
| IUPAC Name | N-[3-[1,6-dimethyl-5-[(4-pyridin-4-yl-1,3-thiazol-2-yl)amino]benzimidazol-2-yl]phenyl]ethanesulfonamide |
| SMILES | CCS(=O)(=O)Nc1cccc(-c2nc3cc(Nc4nc(-c5ccncc5)cs4)c(C)cc3n2C)c1 |
| InChI | InChI=1S/C25H24N6O2S2/c1-4-35(32,33)30-19-7-5-6-18(13-19)24-27-21-14-20(16(2)12-23(21)31(24)3)28-25-29-22(15-34-25)17-8-10-26-11-9-17/h5-15,30H,4H2,1-3H3,(H,28,29) |
| InChIKey | CQKJHUPGCLITRS-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 101.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.64 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiazole_amine_M(1)', 'substructure': 'N/A'} |
|---|