C3H10N2 — CID 172750927
1,1,1,2-tetradeuteriopropan-2-ylhydrazine (PubChem CID 172750927) has the molecular formula C3H10N2 and a molecular weight of 78.15 g/mol. Its IUPAC name is 1,1,1,2-tetradeuteriopropan-2-ylhydrazine.
| Compound Name | 1,1,1,2-tetradeuteriopropan-2-ylhydrazine |
|---|---|
| PubChem CID | 172750927 |
| Molecular Formula | C3H10N2 |
| Molecular Weight | 78.15 g/mol |
| Exact Mass | 78.11 |
| IUPAC Name | 1,1,1,2-tetradeuteriopropan-2-ylhydrazine |
| SMILES | [2H]C([2H])([2H])C([2H])(C)NN |
| InChI | InChI=1S/C3H10N2/c1-3(2)5-4/h3,5H,4H2,1-2H3/i1D3,3D |
| InChIKey | KJAQRHMKLVGSCG-VYMTUXDUSA-N |
| XLogP | -0.14 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 5 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 78.15 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|