C56H74N4O16 — CID 172751683
bis[4-(2-hydroxy-2-methylpropanoyl)phenyl]methyl N-[6-[bis[4-(2-hydroxy-2-methylpropanoyl)phenyl]methoxycarbonylamino]hexyl]carbamate;ethyl carbamate (PubChem CID 172751683) has the molecular formula C56H74N4O16 and a molecular weight of 1059.22 g/mol. Its IUPAC name is bis[4-(2-hydroxy-2-methylpropanoyl)phenyl]methyl N-[6-[bis[4-(2-hydroxy-2-methylpropanoyl)phenyl]methoxycarbonylamino]hexyl]carbamate;ethyl carbamate.
| Compound Name | bis[4-(2-hydroxy-2-methylpropanoyl)phenyl]methyl N-[6-[bis[4-(2-hydroxy-2-methylpropanoyl)phenyl]methoxycarbonylamino]hexyl]carbamate;ethyl carbamate |
|---|---|
| PubChem CID | 172751683 |
| Molecular Formula | C56H74N4O16 |
| Molecular Weight | 1059.22 g/mol |
| Exact Mass | 1058.51 |
| IUPAC Name | bis[4-(2-hydroxy-2-methylpropanoyl)phenyl]methyl N-[6-[bis[4-(2-hydroxy-2-methylpropanoyl)phenyl]methoxycarbonylamino]hexyl]carbamate;ethyl carbamate |
| SMILES | CC(C)(O)C(=O)c1ccc(C(OC(=O)NCCCCCCNC(=O)OC(c2ccc(C(=O)C(C)(C)O)cc2)c2ccc(C(=O)C(C)(C)O)cc2)c2ccc(C(=O)C(C)(C)O)cc2)cc1.CCOC(N)=O.CCOC(N)=O |
| InChI | InChI=1S/C50H60N2O12.2C3H7NO2/c1-47(2,59)41(53)35-21-13-31(14-22-35)39(32-15-23-36(24-16-32)42(54)48(3,4)60)63-45(57)51-29-11-9-10-12-30-52-46(58)64-40(33-17-25-37(26-18-33)43(55)49(5,6)61)34-19-27-38(28-20-34)44(56)50(7,8)62;2*1-2-6-3(4)5/h13-28,39-40,59-62H,9-12,29-30H2,1-8H3,(H,51,57)(H,52,58);2*2H2,1H3,(H2,4,5) |
| InChIKey | KLOOCPWEHAIJNQ-UHFFFAOYSA-N |
| XLogP | 7.60 |
| TPSA | 330.50 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 76 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1059.22 |
| LogP ≤ 5 | 7.60 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|