C31H42N2O8 — CID 141194071
8-[bis[4-(2-hydroxy-2-methylpropanoyl)phenyl]methoxycarbonylamino]octylcarbamic acid (PubChem CID 141194071) has the molecular formula C31H42N2O8 and a molecular weight of 570.68 g/mol. Its IUPAC name is 8-[bis[4-(2-hydroxy-2-methylpropanoyl)phenyl]methoxycarbonylamino]octylcarbamic acid.
| Compound Name | 8-[bis[4-(2-hydroxy-2-methylpropanoyl)phenyl]methoxycarbonylamino]octylcarbamic acid |
|---|---|
| PubChem CID | 141194071 |
| Molecular Formula | C31H42N2O8 |
| Molecular Weight | 570.68 g/mol |
| Exact Mass | 570.29 |
| IUPAC Name | 8-[bis[4-(2-hydroxy-2-methylpropanoyl)phenyl]methoxycarbonylamino]octylcarbamic acid |
| SMILES | CC(C)(O)C(=O)c1ccc(C(OC(=O)NCCCCCCCCNC(=O)O)c2ccc(C(=O)C(C)(C)O)cc2)cc1 |
| InChI | InChI=1S/C31H42N2O8/c1-30(2,39)26(34)23-15-11-21(12-16-23)25(22-13-17-24(18-14-22)27(35)31(3,4)40)41-29(38)33-20-10-8-6-5-7-9-19-32-28(36)37/h11-18,25,32,39-40H,5-10,19-20H2,1-4H3,(H,33,38)(H,36,37) |
| InChIKey | YDYFDCJBRNMKMH-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 162.26 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.68 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|