C52H54O12 — CID 91551934
bis[bis[4-(2-hydroxy-2-methylpropanoyl)phenyl]methyl] 6-methylcyclohepta-1,3,5-triene-1,4-dicarboxylate (PubChem CID 91551934) has the molecular formula C52H54O12 and a molecular weight of 870.99 g/mol. Its IUPAC name is bis[bis[4-(2-hydroxy-2-methylpropanoyl)phenyl]methyl] 6-methylcyclohepta-1,3,5-triene-1,4-dicarboxylate.
| Compound Name | bis[bis[4-(2-hydroxy-2-methylpropanoyl)phenyl]methyl] 6-methylcyclohepta-1,3,5-triene-1,4-dicarboxylate |
|---|---|
| PubChem CID | 91551934 |
| Molecular Formula | C52H54O12 |
| Molecular Weight | 870.99 g/mol |
| Exact Mass | 870.36 |
| IUPAC Name | bis[bis[4-(2-hydroxy-2-methylpropanoyl)phenyl]methyl] 6-methylcyclohepta-1,3,5-triene-1,4-dicarboxylate |
| SMILES | CC1=CC(C(=O)OC(c2ccc(C(=O)C(C)(C)O)cc2)c2ccc(C(=O)C(C)(C)O)cc2)=CC=C(C(=O)OC(c2ccc(C(=O)C(C)(C)O)cc2)c2ccc(C(=O)C(C)(C)O)cc2)C1 |
| InChI | InChI=1S/C52H54O12/c1-30-28-39(47(57)63-41(31-10-18-35(19-11-31)43(53)49(2,3)59)32-12-20-36(21-13-32)44(54)50(4,5)60)26-27-40(29-30)48(58)64-42(33-14-22-37(23-15-33)45(55)51(6,7)61)34-16-24-38(25-17-34)46(56)52(8,9)62/h10-28,41-42,59-62H,29H2,1-9H3 |
| InChIKey | QMSWQYQXFIROOL-UHFFFAOYSA-N |
| XLogP | 7.67 |
| TPSA | 201.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 64 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 870.99 |
| LogP ≤ 5 | 7.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |