C17H14ClFN4OS — CID 17275685
1-[[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl]-3-(4-fluorophenyl)-1-methylthiourea (PubChem CID 17275685) has the molecular formula C17H14ClFN4OS and a molecular weight of 376.84 g/mol. Its IUPAC name is 1-[[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl]-3-(4-fluorophenyl)-1-methylthiourea.
| Compound Name | 1-[[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl]-3-(4-fluorophenyl)-1-methylthiourea |
|---|---|
| PubChem CID | 17275685 |
| Molecular Formula | C17H14ClFN4OS |
| Molecular Weight | 376.84 g/mol |
| Exact Mass | 376.06 |
| IUPAC Name | 1-[[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl]-3-(4-fluorophenyl)-1-methylthiourea |
| SMILES | CN(Cc1nc(-c2ccc(Cl)cc2)no1)C(=S)Nc1ccc(F)cc1 |
| InChI | InChI=1S/C17H14ClFN4OS/c1-23(17(25)20-14-8-6-13(19)7-9-14)10-15-21-16(22-24-15)11-2-4-12(18)5-3-11/h2-9H,10H2,1H3,(H,20,25) |
| InChIKey | FZOWNQXIFVFVFS-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 54.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.84 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|