C6H9N3S — CID 172757828
N,N-dimethyl-1H-pyrazole-4-carbothioamide (PubChem CID 172757828) has the molecular formula C6H9N3S and a molecular weight of 155.23 g/mol. Its IUPAC name is N,N-dimethyl-1H-pyrazole-4-carbothioamide.
| Compound Name | N,N-dimethyl-1H-pyrazole-4-carbothioamide |
|---|---|
| PubChem CID | 172757828 |
| Molecular Formula | C6H9N3S |
| Molecular Weight | 155.23 g/mol |
| Exact Mass | 155.05 |
| IUPAC Name | N,N-dimethyl-1H-pyrazole-4-carbothioamide |
| SMILES | CN(C)C(=S)c1cn[nH]c1 |
| InChI | InChI=1S/C6H9N3S/c1-9(2)6(10)5-3-7-8-4-5/h3-4H,1-2H3,(H,7,8) |
| InChIKey | LGRSEMRBYMRLCW-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 31.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.23 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|