C8H10N2 — CID 138567214
4-[(3E)-penta-1,3-dien-3-yl]-1H-pyrazole (PubChem CID 138567214) has the molecular formula C8H10N2 and a molecular weight of 134.18 g/mol. Its IUPAC name is 4-[(3E)-penta-1,3-dien-3-yl]-1H-pyrazole.
| Compound Name | 4-[(3E)-penta-1,3-dien-3-yl]-1H-pyrazole |
|---|---|
| PubChem CID | 138567214 |
| Molecular Formula | C8H10N2 |
| Molecular Weight | 134.18 g/mol |
| Exact Mass | 134.08 |
| IUPAC Name | 4-[(3E)-penta-1,3-dien-3-yl]-1H-pyrazole |
| SMILES | C=C/C(=C\C)c1cn[nH]c1 |
| InChI | InChI=1S/C8H10N2/c1-3-7(4-2)8-5-9-10-6-8/h3-6H,1H2,2H3,(H,9,10)/b7-4+ |
| InChIKey | ZZDSYGUTKCDSTQ-QPJJXVBHSA-N |
| XLogP | 2.00 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 134.18 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|