About ethane;ethene;4-[(4Z)-3-propan-2-ylidenehexa-1,4-dien-2-yl]-1H-pyrazole
ethane;ethene;4-[(4Z)-3-propan-2-ylidenehexa-1,4-dien-2-yl]-1H-pyrazole (PubChem CID 145146844) has the molecular formula C16H26N2
and a molecular weight of 246.40 g/mol. Its IUPAC name is ethane;ethene;4-[(4Z)-3-propan-2-ylidenehexa-1,4-dien-2-yl]-1H-pyrazole.
Molecular Properties
| Compound Name | ethane;ethene;4-[(4Z)-3-propan-2-ylidenehexa-1,4-dien-2-yl]-1H-pyrazole |
| PubChem CID | 145146844 |
| Molecular Formula | C16H26N2 |
| Molecular Weight | 246.40 g/mol |
| Exact Mass | 246.21 |
| IUPAC Name | ethane;ethene;4-[(4Z)-3-propan-2-ylidenehexa-1,4-dien-2-yl]-1H-pyrazole |
| SMILES | C=C.C=C(C(/C=C\C)=C(C)C)c1cn[nH]c1.CC |
| InChI | InChI=1S/C12H16N2.C2H6.C2H4/c1-5-6-12(9(2)3)10(4)11-7-13-14-8-11;2*1-2/h5-8H,4H2,1-3H3,(H,13,14);1-2H3;1-2H2/b6-5-;; |
| InChIKey | SWCODIVVCJIESG-XNOMRPDFSA-N |
| XLogP | 5.16 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 246.40 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze ethane;ethene;4-[(4Z)-3-propan-2-ylidenehexa-1,4-dien-2-yl]-1H-pyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;ethene;4-[(4Z)-3-propan-2-ylidenehexa-1,4-dien-2-yl]-1H-pyrazole?
The IUPAC name of ethane;ethene;4-[(4Z)-3-propan-2-ylidenehexa-1,4-dien-2-yl]-1H-pyrazole (CID 145146844) is ethane;ethene;4-[(4Z)-3-propan-2-ylidenehexa-1,4-dien-2-yl]-1H-pyrazole.
What is the SMILES notation for ethane;ethene;4-[(4Z)-3-propan-2-ylidenehexa-1,4-dien-2-yl]-1H-pyrazole?
The canonical SMILES for ethane;ethene;4-[(4Z)-3-propan-2-ylidenehexa-1,4-dien-2-yl]-1H-pyrazole is C=C.C=C(C(/C=C\C)=C(C)C)c1cn[nH]c1.CC.
What is the InChIKey of ethane;ethene;4-[(4Z)-3-propan-2-ylidenehexa-1,4-dien-2-yl]-1H-pyrazole?
The InChIKey is SWCODIVVCJIESG-XNOMRPDFSA-N. The full InChI is InChI=1S/C12H16N2.C2H6.C2H4/c1-5-6-12(9(2)3)10(4)11-7-13-14-8-11;2*1-2/h5-8H,4H2,1-3H3,(H,13,14);1-2H3;1-2H2/b6-5-;;.
What are the key properties of ethane;ethene;4-[(4Z)-3-propan-2-ylidenehexa-1,4-dien-2-yl]-1H-pyrazole?
ethane;ethene;4-[(4Z)-3-propan-2-ylidenehexa-1,4-dien-2-yl]-1H-pyrazole has a molecular weight of 246.40 g/mol, XLogP of 5.16, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;ethene;4-[(4Z)-3-propan-2-ylidenehexa-1,4-dien-2-yl]-1H-pyrazole is sourced from PubChem (CID 145146844), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).