C16H26N2 — CID 145146844
ethane;ethene;4-[(4Z)-3-propan-2-ylidenehexa-1,4-dien-2-yl]-1H-pyrazole (PubChem CID 145146844) has the molecular formula C16H26N2 and a molecular weight of 246.40 g/mol. Its IUPAC name is ethane;ethene;4-[(4Z)-3-propan-2-ylidenehexa-1,4-dien-2-yl]-1H-pyrazole.
| Compound Name | ethane;ethene;4-[(4Z)-3-propan-2-ylidenehexa-1,4-dien-2-yl]-1H-pyrazole |
|---|---|
| PubChem CID | 145146844 |
| Molecular Formula | C16H26N2 |
| Molecular Weight | 246.40 g/mol |
| Exact Mass | 246.21 |
| IUPAC Name | ethane;ethene;4-[(4Z)-3-propan-2-ylidenehexa-1,4-dien-2-yl]-1H-pyrazole |
| SMILES | C=C.C=C(C(/C=C\C)=C(C)C)c1cn[nH]c1.CC |
| InChI | InChI=1S/C12H16N2.C2H6.C2H4/c1-5-6-12(9(2)3)10(4)11-7-13-14-8-11;2*1-2/h5-8H,4H2,1-3H3,(H,13,14);1-2H3;1-2H2/b6-5-;; |
| InChIKey | SWCODIVVCJIESG-XNOMRPDFSA-N |
| XLogP | 5.16 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.40 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|