About 4-[(1E,3Z)-1-bromopenta-1,3-dienyl]-1H-pyrazole
4-[(1E,3Z)-1-bromopenta-1,3-dienyl]-1H-pyrazole (PubChem CID 143148023) has the molecular formula C8H9BrN2
and a molecular weight of 213.08 g/mol. Its IUPAC name is 4-[(1E,3Z)-1-bromopenta-1,3-dienyl]-1H-pyrazole.
Molecular Properties
| Compound Name | 4-[(1E,3Z)-1-bromopenta-1,3-dienyl]-1H-pyrazole |
| PubChem CID | 143148023 |
| Molecular Formula | C8H9BrN2 |
| Molecular Weight | 213.08 g/mol |
| Exact Mass | 211.99 |
| IUPAC Name | 4-[(1E,3Z)-1-bromopenta-1,3-dienyl]-1H-pyrazole |
| SMILES | C/C=C\C=C(\Br)c1cn[nH]c1 |
| InChI | InChI=1S/C8H9BrN2/c1-2-3-4-8(9)7-5-10-11-6-7/h2-6H,1H3,(H,10,11)/b3-2-,8-4+ |
| InChIKey | GOUOBGFUVXYVPT-SOBRUKQLSA-N |
| XLogP | 2.72 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.08 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 4-[(1E,3Z)-1-bromopenta-1,3-dienyl]-1H-pyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(1E,3Z)-1-bromopenta-1,3-dienyl]-1H-pyrazole?
The IUPAC name of 4-[(1E,3Z)-1-bromopenta-1,3-dienyl]-1H-pyrazole (CID 143148023) is 4-[(1E,3Z)-1-bromopenta-1,3-dienyl]-1H-pyrazole.
What is the SMILES notation for 4-[(1E,3Z)-1-bromopenta-1,3-dienyl]-1H-pyrazole?
The canonical SMILES for 4-[(1E,3Z)-1-bromopenta-1,3-dienyl]-1H-pyrazole is C/C=C\C=C(\Br)c1cn[nH]c1.
What is the InChIKey of 4-[(1E,3Z)-1-bromopenta-1,3-dienyl]-1H-pyrazole?
The InChIKey is GOUOBGFUVXYVPT-SOBRUKQLSA-N. The full InChI is InChI=1S/C8H9BrN2/c1-2-3-4-8(9)7-5-10-11-6-7/h2-6H,1H3,(H,10,11)/b3-2-,8-4+.
What are the key properties of 4-[(1E,3Z)-1-bromopenta-1,3-dienyl]-1H-pyrazole?
4-[(1E,3Z)-1-bromopenta-1,3-dienyl]-1H-pyrazole has a molecular weight of 213.08 g/mol, XLogP of 2.72, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(1E,3Z)-1-bromopenta-1,3-dienyl]-1H-pyrazole is sourced from PubChem (CID 143148023), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).