C11H18N2 — CID 143862228
ethane;4-(4-methylpenta-1,3-dien-2-yl)-1H-pyrazole (PubChem CID 143862228) has the molecular formula C11H18N2 and a molecular weight of 178.28 g/mol. Its IUPAC name is ethane;4-(4-methylpenta-1,3-dien-2-yl)-1H-pyrazole.
| Compound Name | ethane;4-(4-methylpenta-1,3-dien-2-yl)-1H-pyrazole |
|---|---|
| PubChem CID | 143862228 |
| Molecular Formula | C11H18N2 |
| Molecular Weight | 178.28 g/mol |
| Exact Mass | 178.15 |
| IUPAC Name | ethane;4-(4-methylpenta-1,3-dien-2-yl)-1H-pyrazole |
| SMILES | C=C(C=C(C)C)c1cn[nH]c1.CC |
| InChI | InChI=1S/C9H12N2.C2H6/c1-7(2)4-8(3)9-5-10-11-6-9;1-2/h4-6H,3H2,1-2H3,(H,10,11);1-2H3 |
| InChIKey | OMFFOQKUCXUKAA-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.28 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|