About ethane;4-(4-methylpenta-1,3-dien-2-yl)-1H-pyrazole
ethane;4-(4-methylpenta-1,3-dien-2-yl)-1H-pyrazole (PubChem CID 143862228) has the molecular formula C11H18N2
and a molecular weight of 178.28 g/mol. Its IUPAC name is ethane;4-(4-methylpenta-1,3-dien-2-yl)-1H-pyrazole.
Molecular Properties
| Compound Name | ethane;4-(4-methylpenta-1,3-dien-2-yl)-1H-pyrazole |
| PubChem CID | 143862228 |
| Molecular Formula | C11H18N2 |
| Molecular Weight | 178.28 g/mol |
| Exact Mass | 178.15 |
| IUPAC Name | ethane;4-(4-methylpenta-1,3-dien-2-yl)-1H-pyrazole |
| SMILES | C=C(C=C(C)C)c1cn[nH]c1.CC |
| InChI | InChI=1S/C9H12N2.C2H6/c1-7(2)4-8(3)9-5-10-11-6-9;1-2/h4-6H,3H2,1-2H3,(H,10,11);1-2H3 |
| InChIKey | OMFFOQKUCXUKAA-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.28 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze ethane;4-(4-methylpenta-1,3-dien-2-yl)-1H-pyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;4-(4-methylpenta-1,3-dien-2-yl)-1H-pyrazole?
The IUPAC name of ethane;4-(4-methylpenta-1,3-dien-2-yl)-1H-pyrazole (CID 143862228) is ethane;4-(4-methylpenta-1,3-dien-2-yl)-1H-pyrazole.
What is the SMILES notation for ethane;4-(4-methylpenta-1,3-dien-2-yl)-1H-pyrazole?
The canonical SMILES for ethane;4-(4-methylpenta-1,3-dien-2-yl)-1H-pyrazole is C=C(C=C(C)C)c1cn[nH]c1.CC.
What is the InChIKey of ethane;4-(4-methylpenta-1,3-dien-2-yl)-1H-pyrazole?
The InChIKey is OMFFOQKUCXUKAA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N2.C2H6/c1-7(2)4-8(3)9-5-10-11-6-9;1-2/h4-6H,3H2,1-2H3,(H,10,11);1-2H3.
What are the key properties of ethane;4-(4-methylpenta-1,3-dien-2-yl)-1H-pyrazole?
ethane;4-(4-methylpenta-1,3-dien-2-yl)-1H-pyrazole has a molecular weight of 178.28 g/mol, XLogP of 3.42, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;4-(4-methylpenta-1,3-dien-2-yl)-1H-pyrazole is sourced from PubChem (CID 143862228), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).