C12H18N2 — CID 153334861
4-[(2E,4E)-5,6-dimethylhepta-2,4-dien-2-yl]-1H-pyrazole (PubChem CID 153334861) has the molecular formula C12H18N2 and a molecular weight of 190.29 g/mol. Its IUPAC name is 4-[(2E,4E)-5,6-dimethylhepta-2,4-dien-2-yl]-1H-pyrazole.
| Compound Name | 4-[(2E,4E)-5,6-dimethylhepta-2,4-dien-2-yl]-1H-pyrazole |
|---|---|
| PubChem CID | 153334861 |
| Molecular Formula | C12H18N2 |
| Molecular Weight | 190.29 g/mol |
| Exact Mass | 190.15 |
| IUPAC Name | 4-[(2E,4E)-5,6-dimethylhepta-2,4-dien-2-yl]-1H-pyrazole |
| SMILES | C/C(=C\C=C(/C)C(C)C)c1cn[nH]c1 |
| InChI | InChI=1S/C12H18N2/c1-9(2)10(3)5-6-11(4)12-7-13-14-8-12/h5-9H,1-4H3,(H,13,14)/b10-5+,11-6+ |
| InChIKey | XOSVUOVQGSPFMP-YOYBCKCWSA-N |
| XLogP | 3.42 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.29 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|