C11H18N4 — CID 174348098
1-N,1-N'-dimethyl-1-N'-[(1Z)-1-(1H-pyrazol-4-yl)buta-1,3-dienyl]ethane-1,1-diamine (PubChem CID 174348098) has the molecular formula C11H18N4 and a molecular weight of 206.29 g/mol. Its IUPAC name is 1-N,1-N'-dimethyl-1-N'-[(1Z)-1-(1H-pyrazol-4-yl)buta-1,3-dienyl]ethane-1,1-diamine.
| Compound Name | 1-N,1-N'-dimethyl-1-N'-[(1Z)-1-(1H-pyrazol-4-yl)buta-1,3-dienyl]ethane-1,1-diamine |
|---|---|
| PubChem CID | 174348098 |
| Molecular Formula | C11H18N4 |
| Molecular Weight | 206.29 g/mol |
| Exact Mass | 206.15 |
| IUPAC Name | 1-N,1-N'-dimethyl-1-N'-[(1Z)-1-(1H-pyrazol-4-yl)buta-1,3-dienyl]ethane-1,1-diamine |
| SMILES | C=C/C=C(/c1cn[nH]c1)N(C)C(C)NC |
| InChI | InChI=1S/C11H18N4/c1-5-6-11(10-7-13-14-8-10)15(4)9(2)12-3/h5-9,12H,1H2,2-4H3,(H,13,14)/b11-6- |
| InChIKey | JIJBWDLXHLQNSQ-WDZFZDKYSA-N |
| XLogP | 1.43 |
| TPSA | 43.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.29 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|