C23H24N6O4 — CID 172758177
8-(2-morpholin-4-ylethoxy)-N-(5-nitro-2-pyridinyl)-5,6-dihydrobenzo[h]quinazolin-2-amine (PubChem CID 172758177) has the molecular formula C23H24N6O4 and a molecular weight of 448.48 g/mol. Its IUPAC name is 8-(2-morpholin-4-ylethoxy)-N-(5-nitro-2-pyridinyl)-5,6-dihydrobenzo[h]quinazolin-2-amine.
| Compound Name | 8-(2-morpholin-4-ylethoxy)-N-(5-nitro-2-pyridinyl)-5,6-dihydrobenzo[h]quinazolin-2-amine |
|---|---|
| PubChem CID | 172758177 |
| Molecular Formula | C23H24N6O4 |
| Molecular Weight | 448.48 g/mol |
| Exact Mass | 448.19 |
| IUPAC Name | 8-(2-morpholin-4-ylethoxy)-N-(5-nitro-2-pyridinyl)-5,6-dihydrobenzo[h]quinazolin-2-amine |
| SMILES | O=[N+]([O-])c1ccc(Nc2ncc3c(n2)-c2ccc(OCCN4CCOCC4)cc2CC3)nc1 |
| InChI | InChI=1S/C23H24N6O4/c30-29(31)18-3-6-21(24-15-18)26-23-25-14-17-2-1-16-13-19(4-5-20(16)22(17)27-23)33-12-9-28-7-10-32-11-8-28/h3-6,13-15H,1-2,7-12H2,(H,24,25,26,27) |
| InChIKey | LHWGPWBOMCSTRT-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 115.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.48 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|