C9H6FNO2S2 — CID 172758679
methyl 4-fluoro-2-sulfanylidene-3H-1,3-benzothiazole-6-carboxylate (PubChem CID 172758679) has the molecular formula C9H6FNO2S2 and a molecular weight of 243.28 g/mol. Its IUPAC name is methyl 4-fluoro-2-sulfanylidene-3H-1,3-benzothiazole-6-carboxylate.
| Compound Name | methyl 4-fluoro-2-sulfanylidene-3H-1,3-benzothiazole-6-carboxylate |
|---|---|
| PubChem CID | 172758679 |
| Molecular Formula | C9H6FNO2S2 |
| Molecular Weight | 243.28 g/mol |
| Exact Mass | 242.98 |
| IUPAC Name | methyl 4-fluoro-2-sulfanylidene-3H-1,3-benzothiazole-6-carboxylate |
| SMILES | COC(=O)c1cc(F)c2[nH]c(=S)sc2c1 |
| InChI | InChI=1S/C9H6FNO2S2/c1-13-8(12)4-2-5(10)7-6(3-4)15-9(14)11-7/h2-3H,1H3,(H,11,14) |
| InChIKey | HAXAUWBMCOKQBF-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.28 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|