C21H23NO3 — CID 172759129
2-[(3-methylphenyl)methyl]-N-(1-oxo-3H-2-benzofuran-5-yl)pentanamide (PubChem CID 172759129) has the molecular formula C21H23NO3 and a molecular weight of 337.42 g/mol. Its IUPAC name is 2-[(3-methylphenyl)methyl]-N-(1-oxo-3H-2-benzofuran-5-yl)pentanamide.
| Compound Name | 2-[(3-methylphenyl)methyl]-N-(1-oxo-3H-2-benzofuran-5-yl)pentanamide |
|---|---|
| PubChem CID | 172759129 |
| Molecular Formula | C21H23NO3 |
| Molecular Weight | 337.42 g/mol |
| Exact Mass | 337.17 |
| IUPAC Name | 2-[(3-methylphenyl)methyl]-N-(1-oxo-3H-2-benzofuran-5-yl)pentanamide |
| SMILES | CCCC(Cc1cccc(C)c1)C(=O)Nc1ccc2c(c1)COC2=O |
| InChI | InChI=1S/C21H23NO3/c1-3-5-16(11-15-7-4-6-14(2)10-15)20(23)22-18-8-9-19-17(12-18)13-25-21(19)24/h4,6-10,12,16H,3,5,11,13H2,1-2H3,(H,22,23) |
| InChIKey | LLBKOPYKRJOVKU-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.42 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |