C20H19N3O3 — CID 142096586
N-(cyanomethyl)-3-(3-methylphenyl)-2-[(3-oxo-1H-2-benzofuran-5-yl)amino]propanamide (PubChem CID 142096586) has the molecular formula C20H19N3O3 and a molecular weight of 349.39 g/mol. Its IUPAC name is N-(cyanomethyl)-3-(3-methylphenyl)-2-[(3-oxo-1H-2-benzofuran-5-yl)amino]propanamide.
| Compound Name | N-(cyanomethyl)-3-(3-methylphenyl)-2-[(3-oxo-1H-2-benzofuran-5-yl)amino]propanamide |
|---|---|
| PubChem CID | 142096586 |
| Molecular Formula | C20H19N3O3 |
| Molecular Weight | 349.39 g/mol |
| Exact Mass | 349.14 |
| IUPAC Name | N-(cyanomethyl)-3-(3-methylphenyl)-2-[(3-oxo-1H-2-benzofuran-5-yl)amino]propanamide |
| SMILES | Cc1cccc(CC(Nc2ccc3c(c2)C(=O)OC3)C(=O)NCC#N)c1 |
| InChI | InChI=1S/C20H19N3O3/c1-13-3-2-4-14(9-13)10-18(19(24)22-8-7-21)23-16-6-5-15-12-26-20(25)17(15)11-16/h2-6,9,11,18,23H,8,10,12H2,1H3,(H,22,24) |
| InChIKey | HHJFFCHZUPGMRO-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 91.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.39 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|