C27H28N4O2 — CID 102024306
(2R)-3-[3-(aminomethyl)-5-methylphenyl]-N-(cyanomethyl)-2-[(2,2-diphenylacetyl)amino]propanamide (PubChem CID 102024306) has the molecular formula C27H28N4O2 and a molecular weight of 440.55 g/mol. Its IUPAC name is (2R)-3-[3-(aminomethyl)-5-methylphenyl]-N-(cyanomethyl)-2-[(2,2-diphenylacetyl)amino]propanamide.
| Compound Name | (2R)-3-[3-(aminomethyl)-5-methylphenyl]-N-(cyanomethyl)-2-[(2,2-diphenylacetyl)amino]propanamide |
|---|---|
| PubChem CID | 102024306 |
| Molecular Formula | C27H28N4O2 |
| Molecular Weight | 440.55 g/mol |
| Exact Mass | 440.22 |
| IUPAC Name | (2R)-3-[3-(aminomethyl)-5-methylphenyl]-N-(cyanomethyl)-2-[(2,2-diphenylacetyl)amino]propanamide |
| SMILES | Cc1cc(CN)cc(C[C@@H](NC(=O)C(c2ccccc2)c2ccccc2)C(=O)NCC#N)c1 |
| InChI | InChI=1S/C27H28N4O2/c1-19-14-20(16-21(15-19)18-29)17-24(26(32)30-13-12-28)31-27(33)25(22-8-4-2-5-9-22)23-10-6-3-7-11-23/h2-11,14-16,24-25H,13,17-18,29H2,1H3,(H,30,32)(H,31,33)/t24-/m1/s1 |
| InChIKey | WTEIZWRRDVIOCC-XMMPIXPASA-N |
| XLogP | 2.95 |
| TPSA | 108.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.55 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|